CAS 38157-15-2 is the registry number for (R)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(2R)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 38157-15-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (2R)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: NTAGXJQHJQUOOA-SNVBAGLBSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (2R)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | NTAGXJQHJQUOOA-SNVBAGLBSA-N |
| SMILES | C1CC2=CC=CC=C2C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)