CAS 83721-32-8 is the registry number for Palonosetron Impurity 24. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 83721-32-8) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (2S)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: NTAGXJQHJQUOOA-JTQLQIEISA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (2S)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | NTAGXJQHJQUOOA-JTQLQIEISA-N |
| SMILES | C1CC2=CC=CC=C2C[C@H]1C(=O)O |
Computed by PubChem (NCBI)