Products 83721-32-8

CAS 83721-32-8 is the registry number for Palonosetron Impurity 24. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2S)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 83721-32-8) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (2S)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: NTAGXJQHJQUOOA-JTQLQIEISA-N.

Identity
Molecular formulaC11H12O2
Molecular weight176.21 g/mol
IUPAC name(2S)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
InChIKeyNTAGXJQHJQUOOA-JTQLQIEISA-N
SMILESC1CC2=CC=CC=C2C[C@H]1C(=O)O

Computed by PubChem (NCBI)