CAS 383147-55-5 is the registry number for 1-(1,3-Benzodioxol-5-yl)-1h-pyrrole-2-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(1,3-benzodioxol-5-yl)pyrrole-2-carbaldehyde (CAS 383147-55-5) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)pyrrole-2-carbaldehyde. InChIKey: NNKANGSJBQWJSD-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)pyrrole-2-carbaldehyde |
| InChIKey | NNKANGSJBQWJSD-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N3C=CC=C3C=O |
Computed by PubChem (NCBI)