Products 38473-18-6
CAS 38473-18-6 is the registry number for Flavipucine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-6-methyl-2-(3-methylbutanoyl)-1-oxa-7-azaspiro[2.5]oct-5-ene-4,8-dione (CAS 38473-18-6) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2R,3R)-6-methyl-2-(3-methylbutanoyl)-1-oxa-7-azaspiro[2.5]oct-5-ene-4,8-dione. InChIKey: DWCXXICTUDDKTB-JQWIXIFHSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2R,3R)-6-methyl-2-(3-methylbutanoyl)-1-oxa-7-azaspiro[2.5]oct-5-ene-4,8-dione |
| InChIKey | DWCXXICTUDDKTB-JQWIXIFHSA-N |
| SMILES | CC1=CC(=O)[C@]2([C@@H](O2)C(=O)CC(C)C)C(=O)N1 |
Computed by PubChem (NCBI)