Products 38597-39-6
CAS 38597-39-6 appears in our catalog under these names: 4-Nitrophenyl 4-hydroxybenzoate, 4-Nitrophenyl 4-hydroxybenzoate, 97%, 4-Nitrophenyl 4-hydroxybenzoate, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 5g, 2g, 100mg, 250mg, 1g.
(4-nitrophenyl) 4-hydroxybenzoate (CAS 38597-39-6) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: (4-nitrophenyl) 4-hydroxybenzoate. InChIKey: CYWNZPAZMXPMFB-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | (4-nitrophenyl) 4-hydroxybenzoate |
| InChIKey | CYWNZPAZMXPMFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)