Products 38850-91-8
CAS 38850-91-8 is the registry number for 6-Chloro-1,2,3,4-tetrahydro-1-naphthaleneacetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid (CAS 38850-91-8) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 2-(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid. InChIKey: PIMPMHVHHUWATH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 2-(6-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid |
| InChIKey | PIMPMHVHHUWATH-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)Cl)CC(=O)O |
Computed by PubChem (NCBI)