CAS 38940-61-3 appears in our catalog under these names: Methyl 5-acetylnicotinate, Methyl 5-acetylnicotinate 95%, Methyl 5-acetylnicotinate, 95%, 95%, Methyl 5-acetylnicotinate, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1000mg, 100mg, 250mg, 1g.
Methyl 5-acetylpyridine-3-carboxylate (CAS 38940-61-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: methyl 5-acetylpyridine-3-carboxylate. InChIKey: BUKCTHLVWBOTIE-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | methyl 5-acetylpyridine-3-carboxylate |
| InChIKey | BUKCTHLVWBOTIE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CN=C1)C(=O)OC |
Computed by PubChem (NCBI)