CAS 3916-44-7 appears in our catalog under these names: 4'–Nitro–(1,1'–biphenyl)–4–ol, 4-Hydroxy-4'-nitrobiphenyl, >98.0%(GC), 4'-Nitro-[1,1'-biphenyl]-4-ol 98%, [1,1'-Biphenyl]-4-ol, 4'-nitro-, 98%, 98%, 4'-Nitro-[1,1'-biphenyl]-4-ol, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
4-(4-nitrophenyl)phenol (CAS 3916-44-7) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 4-(4-nitrophenyl)phenol. InChIKey: ZNDJDQOECGBUNK-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 4-(4-nitrophenyl)phenol |
| InChIKey | ZNDJDQOECGBUNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)