CAS 39226-87-4 appears in our catalog under these names: 5-Amino-1,2,5,6,7,8-hexahydroquinolin-2-one hydrochloride, 95%, 5-Amino-1,2,5,6,7,8-hexahydroquinolin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-amino-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride (CAS 39226-87-4) is a chemical compound with the molecular formula C9H13ClN2O and a molecular weight of 200.66 g/mol. IUPAC name: 5-amino-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride. InChIKey: BOZFDYCTIDCWMF-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 5-amino-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
| InChIKey | BOZFDYCTIDCWMF-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)NC(=O)C=C2)N.Cl |
Computed by PubChem (NCBI)