CAS 39513-27-4 appears in our catalog under these names: 5-Acetyl-1,3-dihydro-2h-benzimidazol-2-one, 95%, 5-acetyl-2,3-dihydro-1H-1,3-benzodiazol-2-one, 5-Acetyl-1H-benzo[d]imidazol-2(3H)-one. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 5mg, 25mg.
5-acetyl-1,3-dihydrobenzimidazol-2-one (CAS 39513-27-4) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-acetyl-1,3-dihydrobenzimidazol-2-one. InChIKey: WHQVLSZDGFJRJL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-acetyl-1,3-dihydrobenzimidazol-2-one |
| InChIKey | WHQVLSZDGFJRJL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)NC(=O)N2 |
Computed by PubChem (NCBI)