CAS 3981-53-1 is the registry number for Methyl (S)-2-amino-3-(p-tolyl)propanoate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride (CAS 3981-53-1) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride. InChIKey: NBAGSINATBCQNZ-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride |
| InChIKey | NBAGSINATBCQNZ-PPHPATTJSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)