CAS 39896-32-7 appears in our catalog under these names: 1-(3-Nitrophenyl)propan-2-one, 95%, (3-Nitrophenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg.
1-(3-nitrophenyl)propan-2-one (CAS 39896-32-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(3-nitrophenyl)propan-2-one. InChIKey: TYFVYHHUWTVZTM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(3-nitrophenyl)propan-2-one |
| InChIKey | TYFVYHHUWTVZTM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)