Products 39913-88-7
CAS 39913-88-7 appears in our catalog under these names: 3-Benzyl-2,3-dihydro-1,3-thiazol-2-imine hydrochloride, 95%, 3-Benzyl-2,3-dihydro-1,3-thiazol-2-imine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g.
3-benzyl-1,3-thiazol-2-imine;hydrochloride (CAS 39913-88-7) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: 3-benzyl-1,3-thiazol-2-imine;hydrochloride. InChIKey: MVUPICKBYJNSEN-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | 3-benzyl-1,3-thiazol-2-imine;hydrochloride |
| InChIKey | MVUPICKBYJNSEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CSC2=N.Cl |
Computed by PubChem (NCBI)