CAS 40061-50-5 is the registry number for Etoricoxib Impurity 60. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methylsulfonylphenyl)-1-pyridin-3-ylethanone (CAS 40061-50-5) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)-1-pyridin-3-ylethanone. InChIKey: DWKAGCAGFPGSQM-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenyl)-1-pyridin-3-ylethanone |
| InChIKey | DWKAGCAGFPGSQM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)