CAS 40138-18-9 appears in our catalog under these names: 5-Methoxy-2-formylphenylboronic acid, 5-Methoxy-2-formylphenylboronic acid 98%, 5-Methoxy-2-formylphenylboronic acid, 98%, 98%, 5-Methoxy-2-formylphenylboronic acid, 96%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g, 25g, 50g, 100g.
(2-formyl-5-methoxyphenyl)boronic acid (CAS 40138-18-9) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: (2-formyl-5-methoxyphenyl)boronic acid. InChIKey: YISYHZMNRATPRA-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | (2-formyl-5-methoxyphenyl)boronic acid |
| InChIKey | YISYHZMNRATPRA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C=O)(O)O |
Computed by PubChem (NCBI)