Products 402-12-0
CAS 402-12-0 appears in our catalog under these names: 3–Fluoro–4–nitrobenzotrifluoride, 3-Fluoro-4-nitrobenzotrifluoride 97%, 3-Fluoro-4-nitrobenzotrifluoride, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 100g, 10g.
2-fluoro-1-nitro-4-(trifluoromethyl)benzene (CAS 402-12-0) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 2-fluoro-1-nitro-4-(trifluoromethyl)benzene. InChIKey: OBWDPLOCTVOTMA-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 2-fluoro-1-nitro-4-(trifluoromethyl)benzene |
| InChIKey | OBWDPLOCTVOTMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)