CAS 4028-52-8 is the registry number for n-Butyl 4-Nitrobenzenesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Butyl 4-nitrobenzenesulfonate (CAS 4028-52-8) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: butyl 4-nitrobenzenesulfonate. InChIKey: ADYUOCBPFNUGDX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | butyl 4-nitrobenzenesulfonate |
| InChIKey | ADYUOCBPFNUGDX-UHFFFAOYSA-N |
| SMILES | CCCCOS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)