CAS 402821-16-3 is the registry number for (4R)-4-Benzyl-d-glutamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
(2R,4R)-2-amino-4-benzylpentanedioic acid (CAS 402821-16-3) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2R,4R)-2-amino-4-benzylpentanedioic acid. InChIKey: ATCFYQUZTYQTJN-NXEZZACHSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2R,4R)-2-amino-4-benzylpentanedioic acid |
| InChIKey | ATCFYQUZTYQTJN-NXEZZACHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C[C@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)