CAS 40316-84-5 is the registry number for Orobol 5,7,3',4'-tetramethyl ether. Offered by: Biosynth. Available pack sizes: 2mg.
3-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one (CAS 40316-84-5) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one. InChIKey: QDYAOPVBEKBXBV-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
| InChIKey | QDYAOPVBEKBXBV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C(=CC(=C3)OC)OC)OC |
Computed by PubChem (NCBI)