CAS 40353-34-2 appears in our catalog under these names: 7–Nitro–1–tetralone, 7-Nitro-1-tetralone, 97% , 7-Nitro-1-tetralone, >98.0%(GC), 7-Nitro-3,4-dihydronaphthalen-1(2H)-one 97%, 7-Nitro-3,4-dihydronaphthalen-1(2H)-one 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g, 2g, 10g, 1g, 250mg.
7-nitro-3,4-dihydro-2H-naphthalen-1-one (CAS 40353-34-2) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 7-nitro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: GWAQYWSNCVEJMW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | GWAQYWSNCVEJMW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)C1 |
Computed by PubChem (NCBI)