Products 412293-42-6
CAS 412293-42-6 appears in our catalog under these names: 8-Methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid, 95%, 8-Methyl-1,4-dioxaspiro(4.5)decane-8-carboxylic acid, 8-Methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid, 98%, 98%, 8-METHYL-1,4-DIOXASPIRO[4.5]DECANE-8-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 25g, 50g, 100g, 5g, 10g.
8-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (CAS 412293-42-6) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 8-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid. InChIKey: REHMBWJXVOATBQ-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 8-methyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| InChIKey | REHMBWJXVOATBQ-UHFFFAOYSA-N |
| SMILES | CC1(CCC2(CC1)OCCO2)C(=O)O |
Computed by PubChem (NCBI)