CAS 4127-55-3 is the registry number for 1-(2-Methyl-6-nitrophenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-methyl-6-nitrophenyl)ethanone (CAS 4127-55-3) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(2-methyl-6-nitrophenyl)ethanone. InChIKey: OKABSSBMRAWDFQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(2-methyl-6-nitrophenyl)ethanone |
| InChIKey | OKABSSBMRAWDFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])C(=O)C |
Computed by PubChem (NCBI)