CAS 41384-83-2 appears in our catalog under these names: 4-Nitro-1-phenyl-1h-imidazole, 95%, 4–Nitro–1–phenyl–1H–imidazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
4-nitro-1-phenylimidazole (CAS 41384-83-2) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-nitro-1-phenylimidazole. InChIKey: UEGSGHUETRZQDI-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-nitro-1-phenylimidazole |
| InChIKey | UEGSGHUETRZQDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)