CAS 41464-42-0 appears in our catalog under these names: 2,3',5,5'-Tetrachlorobiphenyl, PCB 72, ROTI®Star, 10 mg, glass. Offered by: Biosynth, Roth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
1,3-dichloro-5-(2,5-dichlorophenyl)benzene (CAS 41464-42-0) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 292.0 g/mol. IUPAC name: 1,3-dichloro-5-(2,5-dichlorophenyl)benzene. InChIKey: WBTMFEPLVQOWFI-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 292.0 g/mol |
| IUPAC name | 1,3-dichloro-5-(2,5-dichlorophenyl)benzene |
| InChIKey | WBTMFEPLVQOWFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC(=CC(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)