CAS 41464-48-6 appears in our catalog under these names: 3,3',4,5'-Tetrachlorobiphenyl, PCB 79, ROTI®Star, 10 mg, glass. Offered by: Biosynth, Roth. Available pack sizes: 5ml, 10ml, 25ml, 50ml, 10mg.
1,2-dichloro-4-(3,5-dichlorophenyl)benzene (CAS 41464-48-6) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 292.0 g/mol. IUPAC name: 1,2-dichloro-4-(3,5-dichlorophenyl)benzene. InChIKey: QLCTXEMDCZGPCG-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 292.0 g/mol |
| IUPAC name | 1,2-dichloro-4-(3,5-dichlorophenyl)benzene |
| InChIKey | QLCTXEMDCZGPCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)