CAS 41777-10-0 is the registry number for 5-Bromo-2-formylphenyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromo-2-formylphenyl) acetate (CAS 41777-10-0) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: (5-bromo-2-formylphenyl) acetate. InChIKey: SRGQSOAPMBTYQR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | (5-bromo-2-formylphenyl) acetate |
| InChIKey | SRGQSOAPMBTYQR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1)Br)C=O |
Computed by PubChem (NCBI)