Products 41777-10-0

CAS 41777-10-0 is the registry number for 5-Bromo-2-formylphenyl acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(5-bromo-2-formylphenyl) acetate (CAS 41777-10-0) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: (5-bromo-2-formylphenyl) acetate. InChIKey: SRGQSOAPMBTYQR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrO3
Molecular weight243.05 g/mol
IUPAC name(5-bromo-2-formylphenyl) acetate
InChIKeySRGQSOAPMBTYQR-UHFFFAOYSA-N
SMILESCC(=O)OC1=C(C=CC(=C1)Br)C=O

Computed by PubChem (NCBI)