Products 4181-97-9
CAS 4181-97-9 appears in our catalog under these names: Phenyl 4-methoxybenzoate, 95%, Phenyl 4-Methoxybenzoate, Phenyl 4-Methoxybenzoate, 98%, 98%, Phenyl 4-methoxybenzoate, 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 50mg.
Phenyl 4-methoxybenzoate (CAS 4181-97-9) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: phenyl 4-methoxybenzoate. InChIKey: BNZYBNYNPXKWCM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | phenyl 4-methoxybenzoate |
| InChIKey | BNZYBNYNPXKWCM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)