CAS 42059-78-9 appears in our catalog under these names: 6-Ethyl-3-formylchromone, 98%, 6–Ethyl–3–formylchromone, 6-Ethyl-4-oxo-4H-chromene-3-carbaldehyde 97%, 6-ETHYL-3-FORMYLCHROMONE, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
6-ethyl-4-oxochromene-3-carbaldehyde (CAS 42059-78-9) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 6-ethyl-4-oxochromene-3-carbaldehyde. InChIKey: XCKTXKYXKJJGBA-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 6-ethyl-4-oxochromene-3-carbaldehyde |
| InChIKey | XCKTXKYXKJJGBA-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC=C(C2=O)C=O |
Computed by PubChem (NCBI)