CAS 42521-09-5 appears in our catalog under these names: Methyl 2,6–dichloropyridine–4–carboxylate, Methyl 2,6-dichloroisonicotinate, 97% , Methyl 2,6-dichloroisonicotinate 95%, methyl 2,6-dichloroisonicotinate, 95%, 95%, Methyl 2,6-Dichloroisonicotinate, 95%. Offered by: GLPBio, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 1000g, 100mg, 250mg, 25g, 100g.
Methyl 2,6-dichloropyridine-4-carboxylate (CAS 42521-09-5) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 2,6-dichloropyridine-4-carboxylate. InChIKey: XSKGHSUHOYEBTK-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 2,6-dichloropyridine-4-carboxylate |
| InChIKey | XSKGHSUHOYEBTK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)