CAS 42918-86-5 appears in our catalog under these names: (S)-2-(((Benzyloxy)carbonyl)amino)butanoic Acid, Z–Abu–OH, Z-L-2Abu-OH, (S)-2-(Benzyloxycarbonylamino)butyric acid, 98% , Z-L-alpha-aminobutyric acid. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 50g, 100g, 500g.
(2S)-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 42918-86-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: SZQMTCSQWUYUML-JTQLQIEISA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | SZQMTCSQWUYUML-JTQLQIEISA-N |
| SMILES | CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)