Products 42990-62-5
CAS 42990-62-5 appears in our catalog under these names: L–2–Aminooxy–3–phenylpropanoic acid, (S)-2-(Aminooxy)-3-phenylpropanoic acid, L-2-Aminooxy-3-phenylpropanoic acid, 99.8%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg.
3-(2-aminooxyphenyl)propanoic acid (CAS 42990-62-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3-(2-aminooxyphenyl)propanoic acid. InChIKey: CGVPQHIRIGIDLE-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-(2-aminooxyphenyl)propanoic acid |
| InChIKey | CGVPQHIRIGIDLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC(=O)O)ON |
Computed by PubChem (NCBI)