Products 436092-71-6
CAS 436092-71-6 appears in our catalog under these names: 4-[(Cyclopropylamino)sulfonyl]benzoic acid, 98%, 4–((Cyclopropylamino)sulfonyl)benzoic Acid, 4-((Cyclopropylamino)sulfonyl)benzoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100mg.
4-(cyclopropylsulfamoyl)benzoic acid (CAS 436092-71-6) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 4-(cyclopropylsulfamoyl)benzoic acid. InChIKey: ZVLAZIIUYHMWIM-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 4-(cyclopropylsulfamoyl)benzoic acid |
| InChIKey | ZVLAZIIUYHMWIM-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)