CAS 75032-27-8 is the registry number for Ethyl 2-(4-nitrophenylthio)acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-(4-nitrophenyl)sulfanylacetate (CAS 75032-27-8) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: ethyl 2-(4-nitrophenyl)sulfanylacetate. InChIKey: RUFWJCXCVXSNQN-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | ethyl 2-(4-nitrophenyl)sulfanylacetate |
| InChIKey | RUFWJCXCVXSNQN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CSC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)