CAS 874774-43-3 is the registry number for 6-(Ethylsulfonyl)-2h-1,4-benzoxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
6-ethylsulfonyl-4H-1,4-benzoxazin-3-one (CAS 874774-43-3) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 6-ethylsulfonyl-4H-1,4-benzoxazin-3-one. InChIKey: CLBHSYOAMTZTBM-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 6-ethylsulfonyl-4H-1,4-benzoxazin-3-one |
| InChIKey | CLBHSYOAMTZTBM-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC2=C(C=C1)OCC(=O)N2 |
Computed by PubChem (NCBI)