CAS 61255-60-5 is the registry number for 6-Methylquinoline, sulfate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-methylquinoline;sulfuric acid (CAS 61255-60-5) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 6-methylquinoline;sulfuric acid. InChIKey: NBWMTAGNNSSNES-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 6-methylquinoline;sulfuric acid |
| InChIKey | NBWMTAGNNSSNES-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=CC=C2.OS(=O)(=O)O |
Computed by PubChem (NCBI)