CAS 52962-52-4 appears in our catalog under these names: 4-(1,1-Dioxidoisothiazolidin-2-yl)benzoic acid, 95%, 4-(1,1-Dioxidoisothiazolidin-2-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid (CAS 52962-52-4) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid. InChIKey: DCRLGJUQBZUHLG-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid |
| InChIKey | DCRLGJUQBZUHLG-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)