CAS 712319-44-3 is the registry number for 1-Methanesulfonyl-2,3-dihydro-1h-indole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-methylsulfonyl-2,3-dihydroindole-5-carboxylic acid (CAS 712319-44-3) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 1-methylsulfonyl-2,3-dihydroindole-5-carboxylic acid. InChIKey: JNMXVSCEGKFVJR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 1-methylsulfonyl-2,3-dihydroindole-5-carboxylic acid |
| InChIKey | JNMXVSCEGKFVJR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)