Products 852933-50-7
CAS 852933-50-7 appears in our catalog under these names: 3-(Cyclopropylsulfamoyl)benzoic acid, 97%, 3-(N-Cyclopropylsulfamoyl)benzoic acid, 98%, 3-(N-Cyclopropylsulfamoyl)benzoic acid 97%, 3-(Cyclopropylsulfamoyl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
3-(cyclopropylsulfamoyl)benzoic acid (CAS 852933-50-7) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: 3-(cyclopropylsulfamoyl)benzoic acid. InChIKey: KBRLADOVWCDAEI-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 3-(cyclopropylsulfamoyl)benzoic acid |
| InChIKey | KBRLADOVWCDAEI-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)