CAS 438539-27-6 appears in our catalog under these names: 4-(3-Methyl-1,2,4-oxadiazol-5-yl)phenol, 95%, 4-(3-Methyl-1,2,4-oxadiazol-5-yl)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(3-methyl-1,2,4-oxadiazol-5-yl)phenol (CAS 438539-27-6) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 4-(3-methyl-1,2,4-oxadiazol-5-yl)phenol. InChIKey: YARBCARLULHRKB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)phenol |
| InChIKey | YARBCARLULHRKB-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)