Products 441801-00-9
CAS 441801-00-9 is the registry number for 4,6-Dichloro-3-methyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,6-dichloro-3-methyl-1H-indole-2-carboxylic acid (CAS 441801-00-9) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 4,6-dichloro-3-methyl-1H-indole-2-carboxylic acid. InChIKey: WPRCUFHYPTYFBP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-1H-indole-2-carboxylic acid |
| InChIKey | WPRCUFHYPTYFBP-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)