CAS 442910-92-1 is the registry number for 7-Fluoro-5-methylisatin, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
7-fluoro-5-methyl-1H-indole-2,3-dione (CAS 442910-92-1) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 7-fluoro-5-methyl-1H-indole-2,3-dione. InChIKey: PLDJBBLAQSTSKA-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 7-fluoro-5-methyl-1H-indole-2,3-dione |
| InChIKey | PLDJBBLAQSTSKA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)F)NC(=O)C2=O |
Computed by PubChem (NCBI)