Products 4430-97-1
CAS 4430-97-1 appears in our catalog under these names: DL-dopaquinone, Dopamine Impurity 6, 2-Amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid, 97%. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid (CAS 4430-97-1) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid. InChIKey: AHMIDUVKSGCHAU-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid |
| InChIKey | AHMIDUVKSGCHAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C(=O)C=C1CC(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid, 1,5-Cyclohexadiene-1-propanoic acid, alpha-amino-3,4-dioxo-, alpha-Amino-3,4-dioxo-1,5-cyclohexadiene-1-propanoic acid, DOPAQUINONE, (+-)-, L-dopaquinone, DL-dopaquinone, Dopaquinone Impurity 2, DOPAQUINONE, (+/-)-, 3-(3,4-Dioxocyclohexa-1,5-dien-1-yl)alanine, 1,5-Cyclohexadiene-1-propanoic acid, |A-amino-3,4-dioxo-