CAS 663910-97-2 is the registry number for D-Dopaquinone. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid (CAS 663910-97-2) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: (2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid. InChIKey: AHMIDUVKSGCHAU-ZCFIWIBFSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,4-dioxocyclohexa-1,5-dien-1-yl)propanoic acid |
| InChIKey | AHMIDUVKSGCHAU-ZCFIWIBFSA-N |
| SMILES | C1=CC(=O)C(=O)C=C1C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)