CAS 444113-18-2 is the registry number for Chloro-acetic acid 4-pyrrol-1-yl-phenyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-pyrrol-1-ylphenyl) 2-chloroacetate (CAS 444113-18-2) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: (4-pyrrol-1-ylphenyl) 2-chloroacetate. InChIKey: BAOZKUQEQGGLIZ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | (4-pyrrol-1-ylphenyl) 2-chloroacetate |
| InChIKey | BAOZKUQEQGGLIZ-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)OC(=O)CCl |
Computed by PubChem (NCBI)