Products 4445-59-4
CAS 4445-59-4 appears in our catalog under these names: (1,1'–Biphenyl)–3,5–dicarboxylic acid, [1,1'-Biphenyl]-3,5-dicarboxylic acid, 98%, 98%, [1,1'-Biphenyl]-3,5-dicarboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-phenylbenzene-1,3-dicarboxylic acid (CAS 4445-59-4) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 5-phenylbenzene-1,3-dicarboxylic acid. InChIKey: JJUJLQXTYRRNJE-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 5-phenylbenzene-1,3-dicarboxylic acid |
| InChIKey | JJUJLQXTYRRNJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)