CAS 4492-01-7 is the registry number for 1,3-Diphenyl-1H-pyrazole, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1,3-diphenylpyrazole (CAS 4492-01-7) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 1,3-diphenylpyrazole. InChIKey: LQUBXCVRJZGBLM-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 1,3-diphenylpyrazole |
| InChIKey | LQUBXCVRJZGBLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)