Products 459836-92-1

CAS 459836-92-1 appears in our catalog under these names: 3,6-Difluoro-2-methylbenzoic acid, 95%, 3,6-Difluoro-2-methylbenzoic acid, 98%, 3,6-Difluoro-2-methylbenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg.

Structural formula: {0} (CAS {1})

3,6-difluoro-2-methylbenzoic acid (CAS 459836-92-1) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 3,6-difluoro-2-methylbenzoic acid. InChIKey: MLYPWPUVZHMPGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O2
Molecular weight172.13 g/mol
IUPAC name3,6-difluoro-2-methylbenzoic acid
InChIKeyMLYPWPUVZHMPGJ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1C(=O)O)F)F

Computed by PubChem (NCBI)