Products 4600-04-8
CAS 4600-04-8 appears in our catalog under these names: 1-Phenyl-1H-1,2,3-triazole-4-carboxylic acid, 95%, 1-Phenyl-1H-1,2,3-triazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed, Fluorochem, BLDpharm. Available pack sizes: 250mg, 5g, 1g, 25g, 100mg, 10g.
1-phenyltriazole-4-carboxylic acid (CAS 4600-04-8) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 1-phenyltriazole-4-carboxylic acid. InChIKey: IVDBIFHDJPMBFG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-phenyltriazole-4-carboxylic acid |
| InChIKey | IVDBIFHDJPMBFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Phenyl-1H-1,2,3-triazole-4-carboxylic acid, 1-phenyltriazole-4-carboxylic acid, 1H-1,2,3-Triazole-4-carboxylic acid, 1-phenyl-, 1-phenyl-1,2,3-triazole-4-carboxylic acid, 1,2,3-Triazole-4-carboxylic acid, 1-phenyl-, 1-Phenyl-1H-1,2,3-triazole-4-carboxylicacid, 1-phenyl-1H-[1,2,3] triazole-4-carboxylic acid, 1-phenyl-1H-[1,2,3]triazole-4-carboxylic acid, 1-Phenyl-1H-1,2,3-triazole-4-carboxylic acid #