Products 460039-42-3
CAS 460039-42-3 appears in our catalog under these names: 3-Amino-4-phenylbutanoic acid hydrochloride, 3-Amino-4-phenylbutyric acid hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 0,25g, 10g, 1g, 250mg, 5g.
3-amino-4-phenylbutanoic acid;hydrochloride (CAS 460039-42-3) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 3-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: MQTMGKGSJOPWJW-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 3-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | MQTMGKGSJOPWJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-amino-4-phenylbutanoic acid hydrochloride, 3-amino-4-phenylbutanoic acid;hydrochloride, D-b-Homophenylalanine hydrochloride, L-b-Homophenylalanine hydrochloride, 3-amino-4-phenylbutanoicacidhydrochloride, 3-amino-4-phenyl-butanoic acid;hydrochloride, (3R)-3-amino-4-phenylbutanoic acid,hydrochloride