Products 145149-50-4
CAS 145149-50-4 appears in our catalog under these names: (R)-3-Amino-4-phenylbutyric acid hydrochloride, 98%, H-D-b-HoPhe-OH hydrochloride, 98%, H–D–b–HoPhe–OH HCl, H-D-beta-HPhe-OH*HCl, (R)-3-Amino-4-phenylbutyric acid hydrochloride, 98%, 98%. Offered by: Fluorochem, Combi-blocks, GLPBio, Iris Biotech, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3R)-3-amino-4-phenylbutanoic acid;hydrochloride (CAS 145149-50-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (3R)-3-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: MQTMGKGSJOPWJW-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (3R)-3-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | MQTMGKGSJOPWJW-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-3-Amino-4-phenylbutyric acid hydrochloride, (R)-3-amino-4-phenylbutanoic acid hydrochloride, D-beta-homophenylalanine-HCl, D-beta-Homophenylalanine hydrochloride, (3R)-3-amino-4-phenylbutanoic acid;hydrochloride, (3R)-3-amino-4-phenyl-butanoic acid;hydrochloride, H-D-b-HoPhe-OH hydrochloride, H-D-beta-HPhe-OH, H-D-b-HoPhe-OH HCl, (3R)-3-amino-4-phenyl-butanoic acid hydrochloride